C14H17ClFNO4S — CID 138043834
2-(2-chloro-4-fluorophenyl)-4-(oxolan-3-ylsulfonyl)morpholine (PubChem CID 138043834) has the molecular formula C14H17ClFNO4S and a molecular weight of 349.81 g/mol. Its IUPAC name is 2-(2-chloro-4-fluorophenyl)-4-(oxolan-3-ylsulfonyl)morpholine.
| Compound Name | 2-(2-chloro-4-fluorophenyl)-4-(oxolan-3-ylsulfonyl)morpholine |
|---|---|
| PubChem CID | 138043834 |
| Molecular Formula | C14H17ClFNO4S |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 2-(2-chloro-4-fluorophenyl)-4-(oxolan-3-ylsulfonyl)morpholine |
| SMILES | O=S(=O)(C1CCOC1)N1CCOC(c2ccc(F)cc2Cl)C1 |
| InChI | InChI=1S/C14H17ClFNO4S/c15-13-7-10(16)1-2-12(13)14-8-17(4-6-21-14)22(18,19)11-3-5-20-9-11/h1-2,7,11,14H,3-6,8-9H2 |
| InChIKey | LPIFWJIKCBPPSA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |