C10H19N5S — CID 79764530
[5-[(3,4-dimethylpiperazin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine (PubChem CID 79764530) has the molecular formula C10H19N5S and a molecular weight of 241.36 g/mol. Its IUPAC name is [5-[(3,4-dimethylpiperazin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-[(3,4-dimethylpiperazin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 79764530 |
| Molecular Formula | C10H19N5S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | [5-[(3,4-dimethylpiperazin-1-yl)methyl]-1,3-thiazol-2-yl]hydrazine |
| SMILES | CC1CN(Cc2cnc(NN)s2)CCN1C |
| InChI | InChI=1S/C10H19N5S/c1-8-6-15(4-3-14(8)2)7-9-5-12-10(13-11)16-9/h5,8H,3-4,6-7,11H2,1-2H3,(H,12,13) |
| InChIKey | GDFHXJIGQOEAKV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|