C11H20N4S — CID 104968911
[5-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-1,3-thiazol-2-yl]hydrazine (PubChem CID 104968911) has the molecular formula C11H20N4S and a molecular weight of 240.38 g/mol. Its IUPAC name is [5-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 104968911 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [5-[[(2S,6R)-2,6-dimethylpiperidin-1-yl]methyl]-1,3-thiazol-2-yl]hydrazine |
| SMILES | C[C@@H]1CCC[C@H](C)N1Cc1cnc(NN)s1 |
| InChI | InChI=1S/C11H20N4S/c1-8-4-3-5-9(2)15(8)7-10-6-13-11(14-12)16-10/h6,8-9H,3-5,7,12H2,1-2H3,(H,13,14)/t8-,9+ |
| InChIKey | GRFKGMWUZQEJQL-DTORHVGOSA-N |
| XLogP | 2.19 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|