About 5-[(2-ethyl-6-methylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine;hydrochloride
5-[(2-ethyl-6-methylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine;hydrochloride (PubChem CID 120899233) has the molecular formula C11H20ClN3OS
and a molecular weight of 277.82 g/mol. Its IUPAC name is 5-[(2-ethyl-6-methylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-[(2-ethyl-6-methylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine;hydrochloride |
| PubChem CID | 120899233 |
| Molecular Formula | C11H20ClN3OS |
| Molecular Weight | 277.82 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 5-[(2-ethyl-6-methylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine;hydrochloride |
| SMILES | CCC1CN(Cc2cnc(N)s2)CC(C)O1.Cl |
| InChI | InChI=1S/C11H19N3OS.ClH/c1-3-9-6-14(5-8(2)15-9)7-10-4-13-11(12)16-10;/h4,8-9H,3,5-7H2,1-2H3,(H2,12,13);1H |
| InChIKey | CCMBDSYXDCGRDX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.82 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2-ethyl-6-methylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-ethyl-6-methylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine;hydrochloride?
The IUPAC name of 5-[(2-ethyl-6-methylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine;hydrochloride (CID 120899233) is 5-[(2-ethyl-6-methylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine;hydrochloride.
What is the SMILES notation for 5-[(2-ethyl-6-methylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine;hydrochloride?
The canonical SMILES for 5-[(2-ethyl-6-methylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine;hydrochloride is CCC1CN(Cc2cnc(N)s2)CC(C)O1.Cl.
What is the InChIKey of 5-[(2-ethyl-6-methylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine;hydrochloride?
The InChIKey is CCMBDSYXDCGRDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3OS.ClH/c1-3-9-6-14(5-8(2)15-9)7-10-4-13-11(12)16-10;/h4,8-9H,3,5-7H2,1-2H3,(H2,12,13);1H.
What are the key properties of 5-[(2-ethyl-6-methylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine;hydrochloride?
5-[(2-ethyl-6-methylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine;hydrochloride has a molecular weight of 277.82 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-ethyl-6-methylmorpholin-4-yl)methyl]-1,3-thiazol-2-amine;hydrochloride is sourced from PubChem (CID 120899233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).