C14H20N2O3S — CID 75448267
N,N-dimethyl-2-phenacylpyrrolidine-1-sulfonamide (PubChem CID 75448267) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is N,N-dimethyl-2-phenacylpyrrolidine-1-sulfonamide.
| Compound Name | N,N-dimethyl-2-phenacylpyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 75448267 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N,N-dimethyl-2-phenacylpyrrolidine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCCC1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H20N2O3S/c1-15(2)20(18,19)16-10-6-9-13(16)11-14(17)12-7-4-3-5-8-12/h3-5,7-8,13H,6,9-11H2,1-2H3 |
| InChIKey | ZCXRBGCXLYRABL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |