C26H25NO2 — CID 122364456
2-[(2S,5R)-5-phenacyl-1-phenylpyrrolidin-2-yl]-1-phenylethanone (PubChem CID 122364456) has the molecular formula C26H25NO2 and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-[(2S,5R)-5-phenacyl-1-phenylpyrrolidin-2-yl]-1-phenylethanone.
| Compound Name | 2-[(2S,5R)-5-phenacyl-1-phenylpyrrolidin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 122364456 |
| Molecular Formula | C26H25NO2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 2-[(2S,5R)-5-phenacyl-1-phenylpyrrolidin-2-yl]-1-phenylethanone |
| SMILES | O=C(C[C@H]1CC[C@@H](CC(=O)c2ccccc2)N1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H25NO2/c28-25(20-10-4-1-5-11-20)18-23-16-17-24(27(23)22-14-8-3-9-15-22)19-26(29)21-12-6-2-7-13-21/h1-15,23-24H,16-19H2/t23-,24+ |
| InChIKey | PQSVJKOVTUFLSZ-PSWAGMNNSA-N |
| XLogP | 5.57 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |