C23H24ClNO3 — CID 122369222
(2R,3R,6S,9aR)-3-chloro-2-hydroxy-6-phenacyl-2-phenyl-3,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one (PubChem CID 122369222) has the molecular formula C23H24ClNO3 and a molecular weight of 397.90 g/mol. Its IUPAC name is (2R,3R,6S,9aR)-3-chloro-2-hydroxy-6-phenacyl-2-phenyl-3,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one.
| Compound Name | (2R,3R,6S,9aR)-3-chloro-2-hydroxy-6-phenacyl-2-phenyl-3,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one |
|---|---|
| PubChem CID | 122369222 |
| Molecular Formula | C23H24ClNO3 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | (2R,3R,6S,9aR)-3-chloro-2-hydroxy-6-phenacyl-2-phenyl-3,6,7,8,9,9a-hexahydro-1H-quinolizin-4-one |
| SMILES | O=C(C[C@@H]1CCC[C@@H]2C[C@@](O)(c3ccccc3)[C@@H](Cl)C(=O)N21)c1ccccc1 |
| InChI | InChI=1S/C23H24ClNO3/c24-21-22(27)25-18(14-20(26)16-8-3-1-4-9-16)12-7-13-19(25)15-23(21,28)17-10-5-2-6-11-17/h1-6,8-11,18-19,21,28H,7,12-15H2/t18-,19+,21-,23+/m0/s1 |
| InChIKey | HBLGKHHQIBEZMK-JROBLHLSSA-N |
| XLogP | 3.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|