About ethyl acetate;2-nitro-N-phenylacetamide
ethyl acetate;2-nitro-N-phenylacetamide (PubChem CID 22005956) has the molecular formula C12H16N2O5
and a molecular weight of 268.27 g/mol. Its IUPAC name is ethyl acetate;2-nitro-N-phenylacetamide.
Molecular Properties
| Compound Name | ethyl acetate;2-nitro-N-phenylacetamide |
| PubChem CID | 22005956 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | ethyl acetate;2-nitro-N-phenylacetamide |
| SMILES | CCOC(C)=O.O=C(C[N+](=O)[O-])Nc1ccccc1 |
| InChI | InChI=1S/C8H8N2O3.C4H8O2/c11-8(6-10(12)13)9-7-4-2-1-3-5-7;1-3-6-4(2)5/h1-5H,6H2,(H,9,11);3H2,1-2H3 |
| InChIKey | RXICGOCCCXGNMW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl acetate;2-nitro-N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl acetate;2-nitro-N-phenylacetamide?
The IUPAC name of ethyl acetate;2-nitro-N-phenylacetamide (CID 22005956) is ethyl acetate;2-nitro-N-phenylacetamide.
What is the SMILES notation for ethyl acetate;2-nitro-N-phenylacetamide?
The canonical SMILES for ethyl acetate;2-nitro-N-phenylacetamide is CCOC(C)=O.O=C(C[N+](=O)[O-])Nc1ccccc1.
What is the InChIKey of ethyl acetate;2-nitro-N-phenylacetamide?
The InChIKey is RXICGOCCCXGNMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3.C4H8O2/c11-8(6-10(12)13)9-7-4-2-1-3-5-7;1-3-6-4(2)5/h1-5H,6H2,(H,9,11);3H2,1-2H3.
What are the key properties of ethyl acetate;2-nitro-N-phenylacetamide?
ethyl acetate;2-nitro-N-phenylacetamide has a molecular weight of 268.27 g/mol, XLogP of 1.47, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl acetate;2-nitro-N-phenylacetamide is sourced from PubChem (CID 22005956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).