C22H30O4 — CID 15005133
diethyl 4-hexyl-1H-naphthalene-2,2-dicarboxylate (PubChem CID 15005133) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is diethyl 4-hexyl-1H-naphthalene-2,2-dicarboxylate.
| Compound Name | diethyl 4-hexyl-1H-naphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 15005133 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | diethyl 4-hexyl-1H-naphthalene-2,2-dicarboxylate |
| SMILES | CCCCCCC1=CC(C(=O)OCC)(C(=O)OCC)Cc2ccccc21 |
| InChI | InChI=1S/C22H30O4/c1-4-7-8-9-12-17-15-22(20(23)25-5-2,21(24)26-6-3)16-18-13-10-11-14-19(17)18/h10-11,13-15H,4-9,12,16H2,1-3H3 |
| InChIKey | JRUBPNXZFRMYRG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|