C19H25NO5 — CID 57227775
ethyl 2-acetamido-1-pentanoyloxy-1,3-dihydroindene-2-carboxylate (PubChem CID 57227775) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is ethyl 2-acetamido-1-pentanoyloxy-1,3-dihydroindene-2-carboxylate.
| Compound Name | ethyl 2-acetamido-1-pentanoyloxy-1,3-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 57227775 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | ethyl 2-acetamido-1-pentanoyloxy-1,3-dihydroindene-2-carboxylate |
| SMILES | CCCCC(=O)OC1c2ccccc2CC1(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C19H25NO5/c1-4-6-11-16(22)25-17-15-10-8-7-9-14(15)12-19(17,20-13(3)21)18(23)24-5-2/h7-10,17H,4-6,11-12H2,1-3H3,(H,20,21) |
| InChIKey | ZXEJJKJLUPEVCA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |