C34H42O6 — CID 139758653
[1-(2-hexoxycarbonyloxy-3,4-dihydronaphthalen-1-yl)-3,4-dihydronaphthalen-2-yl] hexyl carbonate (PubChem CID 139758653) has the molecular formula C34H42O6 and a molecular weight of 546.70 g/mol. Its IUPAC name is [1-(2-hexoxycarbonyloxy-3,4-dihydronaphthalen-1-yl)-3,4-dihydronaphthalen-2-yl] hexyl carbonate.
| Compound Name | [1-(2-hexoxycarbonyloxy-3,4-dihydronaphthalen-1-yl)-3,4-dihydronaphthalen-2-yl] hexyl carbonate |
|---|---|
| PubChem CID | 139758653 |
| Molecular Formula | C34H42O6 |
| Molecular Weight | 546.70 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | [1-(2-hexoxycarbonyloxy-3,4-dihydronaphthalen-1-yl)-3,4-dihydronaphthalen-2-yl] hexyl carbonate |
| SMILES | CCCCCCOC(=O)OC1=C(C2=C(OC(=O)OCCCCCC)CCc3ccccc32)c2ccccc2CC1 |
| InChI | InChI=1S/C34H42O6/c1-3-5-7-13-23-37-33(35)39-29-21-19-25-15-9-11-17-27(25)31(29)32-28-18-12-10-16-26(28)20-22-30(32)40-34(36)38-24-14-8-6-4-2/h9-12,15-18H,3-8,13-14,19-24H2,1-2H3 |
| InChIKey | ZTMPYCJNWIGYFH-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.70 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|