About hexyl (2-phenylphenyl) carbonate;plutonium;dicarbonate
hexyl (2-phenylphenyl) carbonate;plutonium;dicarbonate (PubChem CID 174935978) has the molecular formula C21H22O9Pu-4
and a molecular weight of 662.40 g/mol. Its IUPAC name is hexyl (2-phenylphenyl) carbonate;plutonium;dicarbonate.
Molecular Properties
| Compound Name | hexyl (2-phenylphenyl) carbonate;plutonium;dicarbonate |
| PubChem CID | 174935978 |
| Molecular Formula | C21H22O9Pu-4 |
| Molecular Weight | 662.40 g/mol |
| Exact Mass | 656.18 |
| IUPAC Name | hexyl (2-phenylphenyl) carbonate;plutonium;dicarbonate |
| SMILES | CCCCCCOC(=O)Oc1ccccc1-c1ccccc1.O=C([O-])[O-].O=C([O-])[O-].[Pu] |
| InChI | InChI=1S/C19H22O3.2CH2O3.Pu/c1-2-3-4-10-15-21-19(20)22-18-14-9-8-13-17(18)16-11-6-5-7-12-16;2*2-1(3)4;/h5-9,11-14H,2-4,10,15H2,1H3;2*(H2,2,3,4);/p-4 |
| InChIKey | QPXCCERNTBWKBU-UHFFFAOYSA-J |
| XLogP | 0.56 |
| TPSA | 161.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 662.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze hexyl (2-phenylphenyl) carbonate;plutonium;dicarbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl (2-phenylphenyl) carbonate;plutonium;dicarbonate?
The IUPAC name of hexyl (2-phenylphenyl) carbonate;plutonium;dicarbonate (CID 174935978) is hexyl (2-phenylphenyl) carbonate;plutonium;dicarbonate.
What is the SMILES notation for hexyl (2-phenylphenyl) carbonate;plutonium;dicarbonate?
The canonical SMILES for hexyl (2-phenylphenyl) carbonate;plutonium;dicarbonate is CCCCCCOC(=O)Oc1ccccc1-c1ccccc1.O=C([O-])[O-].O=C([O-])[O-].[Pu].
What is the InChIKey of hexyl (2-phenylphenyl) carbonate;plutonium;dicarbonate?
The InChIKey is QPXCCERNTBWKBU-UHFFFAOYSA-J. The full InChI is InChI=1S/C19H22O3.2CH2O3.Pu/c1-2-3-4-10-15-21-19(20)22-18-14-9-8-13-17(18)16-11-6-5-7-12-16;2*2-1(3)4;/h5-9,11-14H,2-4,10,15H2,1H3;2*(H2,2,3,4);/p-4.
What are the key properties of hexyl (2-phenylphenyl) carbonate;plutonium;dicarbonate?
hexyl (2-phenylphenyl) carbonate;plutonium;dicarbonate has a molecular weight of 662.40 g/mol, XLogP of 0.56, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl (2-phenylphenyl) carbonate;plutonium;dicarbonate is sourced from PubChem (CID 174935978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).