2-hexyl-5-methyl-1,3-dioxane-5-carboxylic acid

C12H22O4 — CID 3477078

IUPAC2-hexyl-5-methyl-1,3-dioxane-5-carboxylic acid
SMILESCCCCCCC1OCC(C)(C(=O)O)CO1
InChIInChI=1S/C12H22O4/c1-3-4-5-6-7-10-15-8-12(2,9-16-10)11(13)14/h10H,3-9H2,1-2H3,(H,13,14)
InChIKeyHMOXVGQDCKMWSD-UHFFFAOYSA-N
MW230.30 g/mol
LogP2.42
Rot. Bonds6

About 2-hexyl-5-methyl-1,3-dioxane-5-carboxylic acid

2-hexyl-5-methyl-1,3-dioxane-5-carboxylic acid (PubChem CID 3477078) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is 2-hexyl-5-methyl-1,3-dioxane-5-carboxylic acid.

Molecular Properties

Compound Name2-hexyl-5-methyl-1,3-dioxane-5-carboxylic acid
PubChem CID3477078
Molecular FormulaC12H22O4
Molecular Weight230.30 g/mol
Exact Mass230.15
IUPAC Name2-hexyl-5-methyl-1,3-dioxane-5-carboxylic acid
SMILESCCCCCCC1OCC(C)(C(=O)O)CO1
InChIInChI=1S/C12H22O4/c1-3-4-5-6-7-10-15-8-12(2,9-16-10)11(13)14/h10H,3-9H2,1-2H3,(H,13,14)
InChIKeyHMOXVGQDCKMWSD-UHFFFAOYSA-N
XLogP2.42
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.30
LogP ≤ 52.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-hexyl-5-methyl-1,3-dioxane-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hexyl-5-methyl-1,3-dioxane-5-carboxylic acid?
The IUPAC name of 2-hexyl-5-methyl-1,3-dioxane-5-carboxylic acid (CID 3477078) is 2-hexyl-5-methyl-1,3-dioxane-5-carboxylic acid.
What is the SMILES notation for 2-hexyl-5-methyl-1,3-dioxane-5-carboxylic acid?
The canonical SMILES for 2-hexyl-5-methyl-1,3-dioxane-5-carboxylic acid is CCCCCCC1OCC(C)(C(=O)O)CO1.
What is the InChIKey of 2-hexyl-5-methyl-1,3-dioxane-5-carboxylic acid?
The InChIKey is HMOXVGQDCKMWSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4/c1-3-4-5-6-7-10-15-8-12(2,9-16-10)11(13)14/h10H,3-9H2,1-2H3,(H,13,14).
What are the key properties of 2-hexyl-5-methyl-1,3-dioxane-5-carboxylic acid?
2-hexyl-5-methyl-1,3-dioxane-5-carboxylic acid has a molecular weight of 230.30 g/mol, XLogP of 2.42, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyl-5-methyl-1,3-dioxane-5-carboxylic acid is sourced from PubChem (CID 3477078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).