C7H12O3 — CID 125452595
(3S,5S)-3,5-dimethyloxolane-3-carboxylic acid (PubChem CID 125452595) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is (3S,5S)-3,5-dimethyloxolane-3-carboxylic acid.
| Compound Name | (3S,5S)-3,5-dimethyloxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 125452595 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | (3S,5S)-3,5-dimethyloxolane-3-carboxylic acid |
| SMILES | C[C@H]1C[C@](C)(C(=O)O)CO1 |
| InChI | InChI=1S/C7H12O3/c1-5-3-7(2,4-10-5)6(8)9/h5H,3-4H2,1-2H3,(H,8,9)/t5-,7-/m0/s1 |
| InChIKey | LALVTZDHKKYCOS-FSPLSTOPSA-N |
| XLogP | 0.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |