C17H30O4 — CID 102103524
(2-heptyl-5-methyl-1,3-dioxan-5-yl)methyl 2-methylprop-2-enoate (PubChem CID 102103524) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is (2-heptyl-5-methyl-1,3-dioxan-5-yl)methyl 2-methylprop-2-enoate.
| Compound Name | (2-heptyl-5-methyl-1,3-dioxan-5-yl)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102103524 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | (2-heptyl-5-methyl-1,3-dioxan-5-yl)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1(C)COC(CCCCCCC)OC1 |
| InChI | InChI=1S/C17H30O4/c1-5-6-7-8-9-10-15-19-11-17(4,12-20-15)13-21-16(18)14(2)3/h15H,2,5-13H2,1,3-4H3 |
| InChIKey | JWMWULQTHXFYOC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|