C22H32O5 — CID 143515230
[(3Z,5E)-5-methoxy-2-methylidenehepta-3,5-dienyl] (3S)-2-hexyl-3-methyl-4-methylidene-5-oxooxolane-3-carboxylate (PubChem CID 143515230) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is [(3Z,5E)-5-methoxy-2-methylidenehepta-3,5-dienyl] (3S)-2-hexyl-3-methyl-4-methylidene-5-oxooxolane-3-carboxylate.
| Compound Name | [(3Z,5E)-5-methoxy-2-methylidenehepta-3,5-dienyl] (3S)-2-hexyl-3-methyl-4-methylidene-5-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 143515230 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [(3Z,5E)-5-methoxy-2-methylidenehepta-3,5-dienyl] (3S)-2-hexyl-3-methyl-4-methylidene-5-oxooxolane-3-carboxylate |
| SMILES | C=C(/C=C\C(=C/C)OC)COC(=O)[C@@]1(C)C(=C)C(=O)OC1CCCCCC |
| InChI | InChI=1S/C22H32O5/c1-7-9-10-11-12-19-22(5,17(4)20(23)27-19)21(24)26-15-16(3)13-14-18(8-2)25-6/h8,13-14,19H,3-4,7,9-12,15H2,1-2,5-6H3/b14-13-,18-8+/t19?,22-/m0/s1 |
| InChIKey | BPTOEASQXAGGKU-SYDXMATASA-N |
| XLogP | 4.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|