C16H25NO7S — CID 156757383
[(2S,3S,4S)-3-hydroxy-6-methoxy-3-methyl-7-methylidene-5-oxo-2-pentyl-2,4-dihydropyrano[2,3-c]pyrrol-4-yl] methanesulfonate (PubChem CID 156757383) has the molecular formula C16H25NO7S and a molecular weight of 375.44 g/mol. Its IUPAC name is [(2S,3S,4S)-3-hydroxy-6-methoxy-3-methyl-7-methylidene-5-oxo-2-pentyl-2,4-dihydropyrano[2,3-c]pyrrol-4-yl] methanesulfonate.
| Compound Name | [(2S,3S,4S)-3-hydroxy-6-methoxy-3-methyl-7-methylidene-5-oxo-2-pentyl-2,4-dihydropyrano[2,3-c]pyrrol-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 156757383 |
| Molecular Formula | C16H25NO7S |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | [(2S,3S,4S)-3-hydroxy-6-methoxy-3-methyl-7-methylidene-5-oxo-2-pentyl-2,4-dihydropyrano[2,3-c]pyrrol-4-yl] methanesulfonate |
| SMILES | C=C1C2=C(C(=O)N1OC)[C@H](OS(C)(=O)=O)[C@@](C)(O)[C@H](CCCCC)O2 |
| InChI | InChI=1S/C16H25NO7S/c1-6-7-8-9-11-16(3,19)14(24-25(5,20)21)12-13(23-11)10(2)17(22-4)15(12)18/h11,14,19H,2,6-9H2,1,3-5H3/t11-,14-,16-/m0/s1 |
| InChIKey | SDGVGFYAGKEMQO-PJODQICGSA-N |
| XLogP | 1.23 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|