C20H28O4 — CID 86609034
benzyl (3S,4S)-3-butyl-2-oxo-4-pentyloxetane-3-carboxylate (PubChem CID 86609034) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is benzyl (3S,4S)-3-butyl-2-oxo-4-pentyloxetane-3-carboxylate.
| Compound Name | benzyl (3S,4S)-3-butyl-2-oxo-4-pentyloxetane-3-carboxylate |
|---|---|
| PubChem CID | 86609034 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | benzyl (3S,4S)-3-butyl-2-oxo-4-pentyloxetane-3-carboxylate |
| SMILES | CCCCC[C@@H]1OC(=O)[C@]1(CCCC)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H28O4/c1-3-5-8-13-17-20(14-6-4-2,19(22)24-17)18(21)23-15-16-11-9-7-10-12-16/h7,9-12,17H,3-6,8,13-15H2,1-2H3/t17-,20-/m0/s1 |
| InChIKey | VZQZIMSXZGZXPD-PXNSSMCTSA-N |
| XLogP | 4.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|