C27H46O7Si — CID 10436383
(1S,2R,3R,7R,9E,11E,14R,16R)-3-[tert-butyl(dimethyl)silyl]oxy-2,18-dimethoxy-7,14-dimethyl-6,19-dioxabicyclo[14.3.0]nonadeca-9,11-diene-5,13-dione (PubChem CID 10436383) has the molecular formula C27H46O7Si and a molecular weight of 510.74 g/mol. Its IUPAC name is (1S,2R,3R,7R,9E,11E,14R,16R)-3-[tert-butyl(dimethyl)silyl]oxy-2,18-dimethoxy-7,14-dimethyl-6,19-dioxabicyclo[14.3.0]nonadeca-9,11-diene-5,13-dione.
| Compound Name | (1S,2R,3R,7R,9E,11E,14R,16R)-3-[tert-butyl(dimethyl)silyl]oxy-2,18-dimethoxy-7,14-dimethyl-6,19-dioxabicyclo[14.3.0]nonadeca-9,11-diene-5,13-dione |
|---|---|
| PubChem CID | 10436383 |
| Molecular Formula | C27H46O7Si |
| Molecular Weight | 510.74 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | (1S,2R,3R,7R,9E,11E,14R,16R)-3-[tert-butyl(dimethyl)silyl]oxy-2,18-dimethoxy-7,14-dimethyl-6,19-dioxabicyclo[14.3.0]nonadeca-9,11-diene-5,13-dione |
| SMILES | COC1C[C@H]2C[C@@H](C)C(=O)/C=C/C=C/C[C@@H](C)OC(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC)[C@H]2O1 |
| InChI | InChI=1S/C27H46O7Si/c1-18-15-20-16-24(30-6)33-25(20)26(31-7)22(34-35(8,9)27(3,4)5)17-23(29)32-19(2)13-11-10-12-14-21(18)28/h10-12,14,18-20,22,24-26H,13,15-17H2,1-9H3/b11-10+,14-12+/t18-,19-,20-,22-,24?,25+,26+/m1/s1 |
| InChIKey | CXVIXSGTVOKSQK-NHPGJAIQSA-N |
| XLogP | 5.20 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.74 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|