C28H53FO5Si2 — CID 101270031
(3aR,4R,6R,7S,7aR)-7-[ditert-butyl(fluoro)silyl]oxy-4-prop-2-enyl-6-[tri(propan-2-yl)silyloxymethyl]-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyran-2-one (PubChem CID 101270031) has the molecular formula C28H53FO5Si2 and a molecular weight of 544.90 g/mol. Its IUPAC name is (3aR,4R,6R,7S,7aR)-7-[ditert-butyl(fluoro)silyl]oxy-4-prop-2-enyl-6-[tri(propan-2-yl)silyloxymethyl]-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyran-2-one.
| Compound Name | (3aR,4R,6R,7S,7aR)-7-[ditert-butyl(fluoro)silyl]oxy-4-prop-2-enyl-6-[tri(propan-2-yl)silyloxymethyl]-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyran-2-one |
|---|---|
| PubChem CID | 101270031 |
| Molecular Formula | C28H53FO5Si2 |
| Molecular Weight | 544.90 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | (3aR,4R,6R,7S,7aR)-7-[ditert-butyl(fluoro)silyl]oxy-4-prop-2-enyl-6-[tri(propan-2-yl)silyloxymethyl]-3,3a,4,6,7,7a-hexahydrofuro[3,2-c]pyran-2-one |
| SMILES | C=CC[C@H]1O[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O[Si](F)(C(C)(C)C)C(C)(C)C)[C@@H]2OC(=O)C[C@@H]21 |
| InChI | InChI=1S/C28H53FO5Si2/c1-14-15-22-21-16-24(30)33-25(21)26(34-36(29,27(8,9)10)28(11,12)13)23(32-22)17-31-35(18(2)3,19(4)5)20(6)7/h14,18-23,25-26H,1,15-17H2,2-13H3/t21-,22-,23-,25-,26-/m1/s1 |
| InChIKey | ZXTMIGZFQXTFQC-DWTKAHDNSA-N |
| XLogP | 7.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.90 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|