C17H30O4Si — CID 11290340
(2R,3aR,7aR)-2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5-one (PubChem CID 11290340) has the molecular formula C17H30O4Si and a molecular weight of 326.51 g/mol. Its IUPAC name is (2R,3aR,7aR)-2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5-one.
| Compound Name | (2R,3aR,7aR)-2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5-one |
|---|---|
| PubChem CID | 11290340 |
| Molecular Formula | C17H30O4Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (2R,3aR,7aR)-2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-2,3,3a,6,7,7a-hexahydrofuro[3,2-b]pyran-5-one |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C[C@H]2OC(=O)CC[C@H]2O1 |
| InChI | InChI=1S/C17H30O4Si/c1-7-8-13(21-22(5,6)17(2,3)4)15-11-14-12(19-15)9-10-16(18)20-14/h7,12-15H,1,8-11H2,2-6H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | JBAWCDRAYORCAY-LXTVHRRPSA-N |
| XLogP | 3.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|