C20H34O5Si — CID 101270028
(1S,2R,6R,7R,9R)-7-but-3-en-2-yl-12,12-ditert-butyl-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one (PubChem CID 101270028) has the molecular formula C20H34O5Si and a molecular weight of 382.57 g/mol. Its IUPAC name is (1S,2R,6R,7R,9R)-7-but-3-en-2-yl-12,12-ditert-butyl-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one.
| Compound Name | (1S,2R,6R,7R,9R)-7-but-3-en-2-yl-12,12-ditert-butyl-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one |
|---|---|
| PubChem CID | 101270028 |
| Molecular Formula | C20H34O5Si |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | (1S,2R,6R,7R,9R)-7-but-3-en-2-yl-12,12-ditert-butyl-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one |
| SMILES | C=CC(C)[C@H]1O[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@H]2[C@@H]2OC(=O)C[C@@H]21 |
| InChI | InChI=1S/C20H34O5Si/c1-9-12(2)16-13-10-15(21)24-17(13)18-14(23-16)11-22-26(25-18,19(3,4)5)20(6,7)8/h9,12-14,16-18H,1,10-11H2,2-8H3/t12?,13-,14-,16-,17-,18-/m1/s1 |
| InChIKey | LAPXAXAEGTYQIU-TVTBIQKWSA-N |
| XLogP | 3.97 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|