C27H48O6Si — CID 11488840
[(2S,3R)-2-[(2S)-but-3-en-2-yl]oxan-3-yl] 3-[(2R,3S,4aR,8aS)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4,4a,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]propanoate (PubChem CID 11488840) has the molecular formula C27H48O6Si and a molecular weight of 496.76 g/mol. Its IUPAC name is [(2S,3R)-2-[(2S)-but-3-en-2-yl]oxan-3-yl] 3-[(2R,3S,4aR,8aS)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4,4a,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]propanoate.
| Compound Name | [(2S,3R)-2-[(2S)-but-3-en-2-yl]oxan-3-yl] 3-[(2R,3S,4aR,8aS)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4,4a,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]propanoate |
|---|---|
| PubChem CID | 11488840 |
| Molecular Formula | C27H48O6Si |
| Molecular Weight | 496.76 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | [(2S,3R)-2-[(2S)-but-3-en-2-yl]oxan-3-yl] 3-[(2R,3S,4aR,8aS)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyl-4,4a,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]propanoate |
| SMILES | C=C[C@H](C)[C@@H]1OCCC[C@H]1OC(=O)CC[C@H]1O[C@H]2CCCO[C@@H]2C[C@]1(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H48O6Si/c1-9-19(2)25-21(13-11-17-30-25)32-24(28)15-14-23-27(6,33-34(7,8)26(3,4)5)18-22-20(31-23)12-10-16-29-22/h9,19-23,25H,1,10-18H2,2-8H3/t19-,20-,21+,22+,23+,25-,27-/m0/s1 |
| InChIKey | GRTWWFKCHSLPOY-YTUOJORWSA-N |
| XLogP | 5.80 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.76 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|