C21H36O5Si — CID 11153694
(1S,2R,6R,7S,9R)-12,12-ditert-butyl-7-(2-methylbut-3-en-2-yl)-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one (PubChem CID 11153694) has the molecular formula C21H36O5Si and a molecular weight of 396.60 g/mol. Its IUPAC name is (1S,2R,6R,7S,9R)-12,12-ditert-butyl-7-(2-methylbut-3-en-2-yl)-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one.
| Compound Name | (1S,2R,6R,7S,9R)-12,12-ditert-butyl-7-(2-methylbut-3-en-2-yl)-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one |
|---|---|
| PubChem CID | 11153694 |
| Molecular Formula | C21H36O5Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (1S,2R,6R,7S,9R)-12,12-ditert-butyl-7-(2-methylbut-3-en-2-yl)-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one |
| SMILES | C=CC(C)(C)[C@H]1O[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@H]2[C@@H]2OC(=O)C[C@@H]21 |
| InChI | InChI=1S/C21H36O5Si/c1-10-21(8,9)18-13-11-15(22)25-16(13)17-14(24-18)12-23-27(26-17,19(2,3)4)20(5,6)7/h10,13-14,16-18H,1,11-12H2,2-9H3/t13-,14+,16+,17+,18-/m0/s1 |
| InChIKey | GLFLBQIUFVOINX-YKJOPOJSSA-N |
| XLogP | 4.36 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|