C23H40O5Si2 — CID 101270030
(1S,2R,5R,6R,7R,9R)-12,12-ditert-butyl-5-[ethenyl(dimethyl)silyl]-7-prop-2-enyl-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one (PubChem CID 101270030) has the molecular formula C23H40O5Si2 and a molecular weight of 452.74 g/mol. Its IUPAC name is (1S,2R,5R,6R,7R,9R)-12,12-ditert-butyl-5-[ethenyl(dimethyl)silyl]-7-prop-2-enyl-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one.
| Compound Name | (1S,2R,5R,6R,7R,9R)-12,12-ditert-butyl-5-[ethenyl(dimethyl)silyl]-7-prop-2-enyl-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one |
|---|---|
| PubChem CID | 101270030 |
| Molecular Formula | C23H40O5Si2 |
| Molecular Weight | 452.74 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | (1S,2R,5R,6R,7R,9R)-12,12-ditert-butyl-5-[ethenyl(dimethyl)silyl]-7-prop-2-enyl-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one |
| SMILES | C=CC[C@H]1O[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@H]2[C@@H]2OC(=O)[C@H]([Si](C)(C)C=C)[C@@H]21 |
| InChI | InChI=1S/C23H40O5Si2/c1-11-13-15-17-19(27-21(24)20(17)29(9,10)12-2)18-16(26-15)14-25-30(28-18,22(3,4)5)23(6,7)8/h11-12,15-20H,1-2,13-14H2,3-10H3/t15-,16-,17-,18-,19-,20-/m1/s1 |
| InChIKey | ACAXOCOIGPVPQV-BZIXAJQCSA-N |
| XLogP | 5.13 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.74 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|