C19H32O5Si — CID 101270022
(1S,2R,6R,7R,9R)-12,12-ditert-butyl-7-prop-2-enyl-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one (PubChem CID 101270022) has the molecular formula C19H32O5Si and a molecular weight of 368.55 g/mol. Its IUPAC name is (1S,2R,6R,7R,9R)-12,12-ditert-butyl-7-prop-2-enyl-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one.
| Compound Name | (1S,2R,6R,7R,9R)-12,12-ditert-butyl-7-prop-2-enyl-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one |
|---|---|
| PubChem CID | 101270022 |
| Molecular Formula | C19H32O5Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (1S,2R,6R,7R,9R)-12,12-ditert-butyl-7-prop-2-enyl-3,8,11,13-tetraoxa-12-silatricyclo[7.4.0.02,6]tridecan-4-one |
| SMILES | C=CC[C@H]1O[C@@H]2CO[Si](C(C)(C)C)(C(C)(C)C)O[C@H]2[C@@H]2OC(=O)C[C@@H]21 |
| InChI | InChI=1S/C19H32O5Si/c1-8-9-13-12-10-15(20)23-16(12)17-14(22-13)11-21-25(24-17,18(2,3)4)19(5,6)7/h8,12-14,16-17H,1,9-11H2,2-7H3/t12-,13-,14-,16-,17-/m1/s1 |
| InChIKey | CBJPWCQTMAJTQC-XPLWTBFPSA-N |
| XLogP | 3.72 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|