C20H38O5Si — CID 11101112
(3R)-3-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethyl]pent-4-enal (PubChem CID 11101112) has the molecular formula C20H38O5Si and a molecular weight of 386.61 g/mol. Its IUPAC name is (3R)-3-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethyl]pent-4-enal.
| Compound Name | (3R)-3-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethyl]pent-4-enal |
|---|---|
| PubChem CID | 11101112 |
| Molecular Formula | C20H38O5Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | (3R)-3-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methoxy-2-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethyl]pent-4-enal |
| SMILES | C=C[C@@H](CC=O)[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1C |
| InChI | InChI=1S/C20H38O5Si/c1-11-15(12-13-21)17(22-8)18(25-26(9,10)19(3,4)5)16-14(2)23-20(6,7)24-16/h11,13-18H,1,12H2,2-10H3/t14-,15+,16+,17+,18+/m1/s1 |
| InChIKey | CUTBMYQBDQTJIS-FPSMNIFISA-N |
| XLogP | 4.32 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|