C21H40O5Si — CID 11957837
(4R)-4-[(4R,5S)-2,2-dimethyl-5-[(1R,2R)-2-methyl-1-triethylsilyloxybut-3-enyl]-1,3-dioxolan-4-yl]-4-methoxybutanal (PubChem CID 11957837) has the molecular formula C21H40O5Si and a molecular weight of 400.63 g/mol. Its IUPAC name is (4R)-4-[(4R,5S)-2,2-dimethyl-5-[(1R,2R)-2-methyl-1-triethylsilyloxybut-3-enyl]-1,3-dioxolan-4-yl]-4-methoxybutanal.
| Compound Name | (4R)-4-[(4R,5S)-2,2-dimethyl-5-[(1R,2R)-2-methyl-1-triethylsilyloxybut-3-enyl]-1,3-dioxolan-4-yl]-4-methoxybutanal |
|---|---|
| PubChem CID | 11957837 |
| Molecular Formula | C21H40O5Si |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | (4R)-4-[(4R,5S)-2,2-dimethyl-5-[(1R,2R)-2-methyl-1-triethylsilyloxybut-3-enyl]-1,3-dioxolan-4-yl]-4-methoxybutanal |
| SMILES | C=C[C@@H](C)[C@@H](O[Si](CC)(CC)CC)[C@H]1OC(C)(C)O[C@@H]1[C@@H](CCC=O)OC |
| InChI | InChI=1S/C21H40O5Si/c1-9-16(5)18(26-27(10-2,11-3)12-4)20-19(24-21(6,7)25-20)17(23-8)14-13-15-22/h9,15-20H,1,10-14H2,2-8H3/t16-,17-,18-,19-,20-/m1/s1 |
| InChIKey | ICRVDSUVPHSABA-LASHMREHSA-N |
| XLogP | 4.71 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|