C16H28O5Si — CID 11077979
(4R,5S)-4-ethenyl-5-[(R)-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]oxolan-2-one (PubChem CID 11077979) has the molecular formula C16H28O5Si and a molecular weight of 328.48 g/mol. Its IUPAC name is (4R,5S)-4-ethenyl-5-[(R)-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]oxolan-2-one.
| Compound Name | (4R,5S)-4-ethenyl-5-[(R)-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]oxolan-2-one |
|---|---|
| PubChem CID | 11077979 |
| Molecular Formula | C16H28O5Si |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (4R,5S)-4-ethenyl-5-[(R)-[(4S,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]-trimethylsilyloxymethyl]oxolan-2-one |
| SMILES | C=C[C@H]1CC(=O)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H]1OC(C)(C)O[C@@H]1C |
| InChI | InChI=1S/C16H28O5Si/c1-8-11-9-12(17)18-14(11)15(21-22(5,6)7)13-10(2)19-16(3,4)20-13/h8,10-11,13-15H,1,9H2,2-7H3/t10-,11+,13+,14+,15+/m1/s1 |
| InChIKey | IKVCMMSZEVXSRN-GCPZOVCVSA-N |
| XLogP | 2.86 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|