C34H62O6Si — CID 11215512
(6R)-6-[(4R,5R)-5-[(Z)-5-[tert-butyl(dimethyl)silyl]oxypent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(4S,6S)-2,2-dimethyl-6-pent-4-enyl-1,3-dioxan-4-yl]heptan-3-one (PubChem CID 11215512) has the molecular formula C34H62O6Si and a molecular weight of 594.95 g/mol. Its IUPAC name is (6R)-6-[(4R,5R)-5-[(Z)-5-[tert-butyl(dimethyl)silyl]oxypent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(4S,6S)-2,2-dimethyl-6-pent-4-enyl-1,3-dioxan-4-yl]heptan-3-one.
| Compound Name | (6R)-6-[(4R,5R)-5-[(Z)-5-[tert-butyl(dimethyl)silyl]oxypent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(4S,6S)-2,2-dimethyl-6-pent-4-enyl-1,3-dioxan-4-yl]heptan-3-one |
|---|---|
| PubChem CID | 11215512 |
| Molecular Formula | C34H62O6Si |
| Molecular Weight | 594.95 g/mol |
| Exact Mass | 594.43 |
| IUPAC Name | (6R)-6-[(4R,5R)-5-[(Z)-5-[tert-butyl(dimethyl)silyl]oxypent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(4S,6S)-2,2-dimethyl-6-pent-4-enyl-1,3-dioxan-4-yl]heptan-3-one |
| SMILES | C=CCCC[C@H]1C[C@H](CCC(=O)CC[C@@H](C)[C@H]2OC(C)(C)O[C@@H]2C/C=C\CCO[Si](C)(C)C(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C34H62O6Si/c1-12-13-15-18-28-25-29(38-33(6,7)37-28)23-22-27(35)21-20-26(2)31-30(39-34(8,9)40-31)19-16-14-17-24-36-41(10,11)32(3,4)5/h12,14,16,26,28-31H,1,13,15,17-25H2,2-11H3/b16-14-/t26-,28+,29+,30-,31-/m1/s1 |
| InChIKey | QNBIZLFJSPGPKD-LWIUOWBXSA-N |
| XLogP | 8.90 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.95 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|