C32H58O6Si — CID 10674519
ethyl (5S,6S,7E,11Z)-5-acetyl-9-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-7,11-dienoate (PubChem CID 10674519) has the molecular formula C32H58O6Si and a molecular weight of 566.90 g/mol. Its IUPAC name is ethyl (5S,6S,7E,11Z)-5-acetyl-9-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-7,11-dienoate.
| Compound Name | ethyl (5S,6S,7E,11Z)-5-acetyl-9-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-7,11-dienoate |
|---|---|
| PubChem CID | 10674519 |
| Molecular Formula | C32H58O6Si |
| Molecular Weight | 566.90 g/mol |
| Exact Mass | 566.40 |
| IUPAC Name | ethyl (5S,6S,7E,11Z)-5-acetyl-9-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-7,11-dienoate |
| SMILES | CCCCC/C=C\CC(/C=C/[C@@H]([C@H](CCCC(=O)OCC)C(C)=O)[C@H]1COC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H58O6Si/c1-11-13-14-15-16-17-19-26(38-39(9,10)31(4,5)6)22-23-28(29-24-36-32(7,8)37-29)27(25(3)33)20-18-21-30(34)35-12-2/h16-17,22-23,26-29H,11-15,18-21,24H2,1-10H3/b17-16-,23-22+/t26?,27-,28+,29-/m1/s1 |
| InChIKey | KYGKLLYCSZYMGY-AZSRVPNUSA-N |
| XLogP | 8.17 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.90 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|