C16H30N2O5Si — CID 135798505
ethyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate (PubChem CID 135798505) has the molecular formula C16H30N2O5Si and a molecular weight of 358.51 g/mol. Its IUPAC name is ethyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate.
| Compound Name | ethyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
|---|---|
| PubChem CID | 135798505 |
| Molecular Formula | C16H30N2O5Si |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | ethyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-diazo-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
| SMILES | CCOC(=O)C(=[N+]=[N-])[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C16H30N2O5Si/c1-9-20-14(19)12(18-17)13(11-10-21-16(5,6)22-11)23-24(7,8)15(2,3)4/h11,13H,9-10H2,1-8H3/t11-,13-/m1/s1 |
| InChIKey | RCITVWNTGWJYHH-DGCLKSJQSA-N |
| XLogP | 2.76 |
| TPSA | 90.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|