C10H16N2O4 — CID 135798502
(4S)-3-diazo-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxybutan-2-one (PubChem CID 135798502) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is (4S)-3-diazo-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxybutan-2-one.
| Compound Name | (4S)-3-diazo-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxybutan-2-one |
|---|---|
| PubChem CID | 135798502 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (4S)-3-diazo-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methoxybutan-2-one |
| SMILES | CO[C@@H](C(=[N+]=[N-])C(C)=O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C10H16N2O4/c1-6(13)8(12-11)9(14-4)7-5-15-10(2,3)16-7/h7,9H,5H2,1-4H3/t7-,9-/m1/s1 |
| InChIKey | FMUDOGMQBUAOPR-VXNVDRBHSA-N |
| XLogP | 0.41 |
| TPSA | 81.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|