C27H50O5Si — CID 102532910
(3R,5S,6R)-6-[(1R,3S,5E,7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methoxy-3,5-dimethyldeca-5,9-dienyl]-5-methoxy-3-methyloxan-2-one (PubChem CID 102532910) has the molecular formula C27H50O5Si and a molecular weight of 482.78 g/mol. Its IUPAC name is (3R,5S,6R)-6-[(1R,3S,5E,7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methoxy-3,5-dimethyldeca-5,9-dienyl]-5-methoxy-3-methyloxan-2-one.
| Compound Name | (3R,5S,6R)-6-[(1R,3S,5E,7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methoxy-3,5-dimethyldeca-5,9-dienyl]-5-methoxy-3-methyloxan-2-one |
|---|---|
| PubChem CID | 102532910 |
| Molecular Formula | C27H50O5Si |
| Molecular Weight | 482.78 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | (3R,5S,6R)-6-[(1R,3S,5E,7R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-methoxy-3,5-dimethyldeca-5,9-dienyl]-5-methoxy-3-methyloxan-2-one |
| SMILES | C=CC[C@H](/C=C(\C)C[C@H](C)C[C@@H](OC)[C@H]1OC(=O)[C@H](C)C[C@@H]1OC)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O5Si/c1-12-13-22(18-31-33(10,11)27(5,6)7)15-19(2)14-20(3)16-23(29-8)25-24(30-9)17-21(4)26(28)32-25/h12,15,20-25H,1,13-14,16-18H2,2-11H3/b19-15+/t20-,21+,22+,23+,24-,25+/m0/s1 |
| InChIKey | JOEMIJMTAPUQSI-UZCSFMDPSA-N |
| XLogP | 6.54 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.78 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|