C19H34O5Si — CID 14811210
ethyl 2-[(3aS,4R,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]acetate (PubChem CID 14811210) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is ethyl 2-[(3aS,4R,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]acetate.
| Compound Name | ethyl 2-[(3aS,4R,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]acetate |
|---|---|
| PubChem CID | 14811210 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | ethyl 2-[(3aS,4R,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1C=C(O[Si](C)(C)C(C)(C)C)C[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C19H34O5Si/c1-9-21-16(20)11-13-10-14(24-25(7,8)18(2,3)4)12-15-17(13)23-19(5,6)22-15/h10,13,15,17H,9,11-12H2,1-8H3/t13-,15+,17-/m0/s1 |
| InChIKey | DNGBVEYJWKQSSX-LXZKKBNFSA-N |
| XLogP | 4.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|