C22H36O7Si — CID 11189902
methyl 5-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate (PubChem CID 11189902) has the molecular formula C22H36O7Si and a molecular weight of 440.61 g/mol. Its IUPAC name is methyl 5-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate.
| Compound Name | methyl 5-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 11189902 |
| Molecular Formula | C22H36O7Si |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | methyl 5-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-oxo-3a,4,5,7a-tetrahydro-1H-2-benzofuran-4-carboxylate |
| SMILES | COC(=O)C1C2C(=O)OCC2C=CC1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H36O7Si/c1-21(2,3)30(7,8)29-18(15-12-27-22(4,5)28-15)14-10-9-13-11-26-20(24)16(13)17(14)19(23)25-6/h9-10,13-18H,11-12H2,1-8H3/t13?,14?,15-,16?,17?,18-/m0/s1 |
| InChIKey | QEOOGGIIFHTUCO-NVMZUBJZSA-N |
| XLogP | 3.29 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|