C29H58O3SiSn — CID 10746155
(4R,6R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-[(E,2R)-4-tributylstannylbut-3-en-2-yl]oxan-2-one (PubChem CID 10746155) has the molecular formula C29H58O3SiSn and a molecular weight of 601.58 g/mol. Its IUPAC name is (4R,6R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-[(E,2R)-4-tributylstannylbut-3-en-2-yl]oxan-2-one.
| Compound Name | (4R,6R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-[(E,2R)-4-tributylstannylbut-3-en-2-yl]oxan-2-one |
|---|---|
| PubChem CID | 10746155 |
| Molecular Formula | C29H58O3SiSn |
| Molecular Weight | 601.58 g/mol |
| Exact Mass | 602.32 |
| IUPAC Name | (4R,6R)-4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-[(E,2R)-4-tributylstannylbut-3-en-2-yl]oxan-2-one |
| SMILES | CCCC[Sn](/C=C/[C@@H](C)[C@H]1C[C@@H](CCO[Si](C)(C)C(C)(C)C)CC(=O)O1)(CCCC)CCCC |
| InChI | InChI=1S/C17H31O3Si.3C4H9.Sn/c1-8-13(2)15-11-14(12-16(18)20-15)9-10-19-21(6,7)17(3,4)5;3*1-3-4-2;/h1,8,13-15H,9-12H2,2-7H3;3*1,3-4H2,2H3;/t13-,14-,15-;;;;/m1..../s1 |
| InChIKey | NLCDXIZEJRIDAO-IORBWHJUSA-N |
| XLogP | 9.30 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.58 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|