C19H36O3Si — CID 10914783
(4S,5R)-4-[[dimethyl(propan-2-yloxy)silyl]methyl]-5-[(2S)-6-methylhept-5-en-2-yl]oxan-2-one (PubChem CID 10914783) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is (4S,5R)-4-[[dimethyl(propan-2-yloxy)silyl]methyl]-5-[(2S)-6-methylhept-5-en-2-yl]oxan-2-one.
| Compound Name | (4S,5R)-4-[[dimethyl(propan-2-yloxy)silyl]methyl]-5-[(2S)-6-methylhept-5-en-2-yl]oxan-2-one |
|---|---|
| PubChem CID | 10914783 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (4S,5R)-4-[[dimethyl(propan-2-yloxy)silyl]methyl]-5-[(2S)-6-methylhept-5-en-2-yl]oxan-2-one |
| SMILES | CC(C)=CCC[C@H](C)[C@H]1COC(=O)C[C@@H]1C[Si](C)(C)OC(C)C |
| InChI | InChI=1S/C19H36O3Si/c1-14(2)9-8-10-16(5)18-12-21-19(20)11-17(18)13-23(6,7)22-15(3)4/h9,15-18H,8,10-13H2,1-7H3/t16-,17+,18+/m0/s1 |
| InChIKey | CUDJXSIRUDHGKG-RCCFBDPRSA-N |
| XLogP | 5.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|