C22H40O4Si — CID 135013812
tert-butyl (5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-2,6-dimethyl-7-oxocycloheptane-1-carboxylate (PubChem CID 135013812) has the molecular formula C22H40O4Si and a molecular weight of 396.64 g/mol. Its IUPAC name is tert-butyl (5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-2,6-dimethyl-7-oxocycloheptane-1-carboxylate.
| Compound Name | tert-butyl (5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-2,6-dimethyl-7-oxocycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 135013812 |
| Molecular Formula | C22H40O4Si |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | tert-butyl (5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-2,6-dimethyl-7-oxocycloheptane-1-carboxylate |
| SMILES | C=CC1(C)CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)C(=O)C1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H40O4Si/c1-12-22(9)14-13-16(26-27(10,11)21(6,7)8)15(2)18(23)17(22)19(24)25-20(3,4)5/h12,15-17H,1,13-14H2,2-11H3/t15?,16-,17?,22?/m0/s1 |
| InChIKey | NDAXEMKADQBMRR-KFAQJWHJSA-N |
| XLogP | 5.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|