C25H46O5Si — CID 101037893
tert-butyl (6R,7S,8S)-4,4,6,8-tetramethyl-3,5-dioxo-7-triethylsilyloxyundec-10-enoate (PubChem CID 101037893) has the molecular formula C25H46O5Si and a molecular weight of 454.72 g/mol. Its IUPAC name is tert-butyl (6R,7S,8S)-4,4,6,8-tetramethyl-3,5-dioxo-7-triethylsilyloxyundec-10-enoate.
| Compound Name | tert-butyl (6R,7S,8S)-4,4,6,8-tetramethyl-3,5-dioxo-7-triethylsilyloxyundec-10-enoate |
|---|---|
| PubChem CID | 101037893 |
| Molecular Formula | C25H46O5Si |
| Molecular Weight | 454.72 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | tert-butyl (6R,7S,8S)-4,4,6,8-tetramethyl-3,5-dioxo-7-triethylsilyloxyundec-10-enoate |
| SMILES | C=CC[C@H](C)[C@H](O[Si](CC)(CC)CC)[C@@H](C)C(=O)C(C)(C)C(=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H46O5Si/c1-12-16-18(5)22(30-31(13-2,14-3)15-4)19(6)23(28)25(10,11)20(26)17-21(27)29-24(7,8)9/h12,18-19,22H,1,13-17H2,2-11H3/t18-,19+,22-/m0/s1 |
| InChIKey | CYZRNOSCINIEBE-JQVVWYNYSA-N |
| XLogP | 6.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.72 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|