C22H42O5Si — CID 11825839
tert-butyl (5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-8,8-dimethyl-3-oxodec-9-enoate (PubChem CID 11825839) has the molecular formula C22H42O5Si and a molecular weight of 414.66 g/mol. Its IUPAC name is tert-butyl (5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-8,8-dimethyl-3-oxodec-9-enoate.
| Compound Name | tert-butyl (5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-8,8-dimethyl-3-oxodec-9-enoate |
|---|---|
| PubChem CID | 11825839 |
| Molecular Formula | C22H42O5Si |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | tert-butyl (5S,7S)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-8,8-dimethyl-3-oxodec-9-enoate |
| SMILES | C=CC(C)(C)[C@H](C[C@H](O)CC(=O)CC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O5Si/c1-12-22(8,9)18(27-28(10,11)21(5,6)7)14-16(23)13-17(24)15-19(25)26-20(2,3)4/h12,16,18,23H,1,13-15H2,2-11H3/t16-,18+/m1/s1 |
| InChIKey | HXTIQLLPXDXKOS-AEFFLSMTSA-N |
| XLogP | 5.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|