C20H38O4Si — CID 10904744
ethyl (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-3-oxodecanoate (PubChem CID 10904744) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is ethyl (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-3-oxodecanoate.
| Compound Name | ethyl (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-3-oxodecanoate |
|---|---|
| PubChem CID | 10904744 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | ethyl (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-3-oxodecanoate |
| SMILES | C=C[C@@H](C(=O)CC(=O)OCC)[C@@H](CCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O4Si/c1-9-12-13-14-18(24-25(7,8)20(4,5)6)16(10-2)17(21)15-19(22)23-11-3/h10,16,18H,2,9,11-15H2,1,3-8H3/t16-,18+/m0/s1 |
| InChIKey | LWCQWYNSPGUYML-FUHWJXTLSA-N |
| XLogP | 5.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|