C32H64O7Si3 — CID 102582080
2-trimethylsilylethyl 5-acetyloxy-9-methyl-7-oxo-3,9-bis(triethylsilyloxy)dodec-11-enoate (PubChem CID 102582080) has the molecular formula C32H64O7Si3 and a molecular weight of 645.12 g/mol. Its IUPAC name is 2-trimethylsilylethyl 5-acetyloxy-9-methyl-7-oxo-3,9-bis(triethylsilyloxy)dodec-11-enoate.
| Compound Name | 2-trimethylsilylethyl 5-acetyloxy-9-methyl-7-oxo-3,9-bis(triethylsilyloxy)dodec-11-enoate |
|---|---|
| PubChem CID | 102582080 |
| Molecular Formula | C32H64O7Si3 |
| Molecular Weight | 645.12 g/mol |
| Exact Mass | 644.40 |
| IUPAC Name | 2-trimethylsilylethyl 5-acetyloxy-9-methyl-7-oxo-3,9-bis(triethylsilyloxy)dodec-11-enoate |
| SMILES | C=CCC(C)(CC(=O)CC(CC(CC(=O)OCC[Si](C)(C)C)O[Si](CC)(CC)CC)OC(C)=O)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C32H64O7Si3/c1-13-20-32(9,39-42(17-5,18-6)19-7)26-28(34)23-29(37-27(8)33)24-30(38-41(14-2,15-3)16-4)25-31(35)36-21-22-40(10,11)12/h13,29-30H,1,14-26H2,2-12H3 |
| InChIKey | UWLCZQSMXZXPIU-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.12 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|