C31H60O3Si2 — CID 134919207
(3R,4S)-4-[(2R,4Z,7Z)-2-[tert-butyl(dimethyl)silyl]oxytrideca-4,7-dienyl]-3-hexyl-3-trimethylsilyloxetan-2-one (PubChem CID 134919207) has the molecular formula C31H60O3Si2 and a molecular weight of 536.99 g/mol. Its IUPAC name is (3R,4S)-4-[(2R,4Z,7Z)-2-[tert-butyl(dimethyl)silyl]oxytrideca-4,7-dienyl]-3-hexyl-3-trimethylsilyloxetan-2-one.
| Compound Name | (3R,4S)-4-[(2R,4Z,7Z)-2-[tert-butyl(dimethyl)silyl]oxytrideca-4,7-dienyl]-3-hexyl-3-trimethylsilyloxetan-2-one |
|---|---|
| PubChem CID | 134919207 |
| Molecular Formula | C31H60O3Si2 |
| Molecular Weight | 536.99 g/mol |
| Exact Mass | 536.41 |
| IUPAC Name | (3R,4S)-4-[(2R,4Z,7Z)-2-[tert-butyl(dimethyl)silyl]oxytrideca-4,7-dienyl]-3-hexyl-3-trimethylsilyloxetan-2-one |
| SMILES | CCCCC/C=C\C/C=C\C[C@H](C[C@@H]1OC(=O)[C@]1(CCCCCC)[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H60O3Si2/c1-11-13-15-17-18-19-20-21-22-24-27(34-36(9,10)30(3,4)5)26-28-31(29(32)33-28,35(6,7)8)25-23-16-14-12-2/h18-19,21-22,27-28H,11-17,20,23-26H2,1-10H3/b19-18-,22-21-/t27-,28+,31-/m1/s1 |
| InChIKey | NHRNSPGEIJSDQX-VHNPVIAKSA-N |
| XLogP | 10.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.99 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|