C20H38O4Si — CID 11783612
methyl 2-[(2R,4S,6S)-6-prop-2-enyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate (PubChem CID 11783612) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is methyl 2-[(2R,4S,6S)-6-prop-2-enyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,4S,6S)-6-prop-2-enyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 11783612 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | methyl 2-[(2R,4S,6S)-6-prop-2-enyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate |
| SMILES | C=CC[C@H]1C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)C[C@H](CC(=O)OC)O1 |
| InChI | InChI=1S/C20H38O4Si/c1-9-10-17-11-19(12-18(23-17)13-20(21)22-8)24-25(14(2)3,15(4)5)16(6)7/h9,14-19H,1,10-13H2,2-8H3/t17-,18+,19-/m0/s1 |
| InChIKey | RMHRWZUDLJQRKG-OTWHNJEPSA-N |
| XLogP | 5.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|