C19H34O5Si — CID 167526425
[(4Z)-12-oxo-10-triethylsilyloxy-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 167526425) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is [(4Z)-12-oxo-10-triethylsilyloxy-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(4Z)-12-oxo-10-triethylsilyloxy-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 167526425 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | [(4Z)-12-oxo-10-triethylsilyloxy-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CC[Si](CC)(CC)OC1CCCC(OC(C)=O)/C=C\CCOC(=O)C1 |
| InChI | InChI=1S/C19H34O5Si/c1-5-25(6-2,7-3)24-18-13-10-12-17(23-16(4)20)11-8-9-14-22-19(21)15-18/h8,11,17-18H,5-7,9-10,12-15H2,1-4H3/b11-8- |
| InChIKey | YTBQZFBDEHDIAH-FLIBITNWSA-N |
| XLogP | 4.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|