C24H48O5Si — CID 5375614
methyl (E)-9,10-dimethoxy-13-trimethylsilyloxyoctadec-11-enoate (PubChem CID 5375614) has the molecular formula C24H48O5Si and a molecular weight of 444.73 g/mol. Its IUPAC name is methyl (E)-9,10-dimethoxy-13-trimethylsilyloxyoctadec-11-enoate.
| Compound Name | methyl (E)-9,10-dimethoxy-13-trimethylsilyloxyoctadec-11-enoate |
|---|---|
| PubChem CID | 5375614 |
| Molecular Formula | C24H48O5Si |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.33 |
| IUPAC Name | methyl (E)-9,10-dimethoxy-13-trimethylsilyloxyoctadec-11-enoate |
| SMILES | CCCCCC(/C=C/C(OC)C(CCCCCCCC(=O)OC)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C24H48O5Si/c1-8-9-13-16-21(29-30(5,6)7)19-20-23(27-3)22(26-2)17-14-11-10-12-15-18-24(25)28-4/h19-23H,8-18H2,1-7H3/b20-19+ |
| InChIKey | OHWZLQONYZSWCJ-FMQUCBEESA-N |
| XLogP | 6.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|