C26H54O5Si2 — CID 5366742
methyl (Z)-11-methoxy-12,13-bis(trimethylsilyloxy)octadec-9-enoate (PubChem CID 5366742) has the molecular formula C26H54O5Si2 and a molecular weight of 502.89 g/mol. Its IUPAC name is methyl (Z)-11-methoxy-12,13-bis(trimethylsilyloxy)octadec-9-enoate.
| Compound Name | methyl (Z)-11-methoxy-12,13-bis(trimethylsilyloxy)octadec-9-enoate |
|---|---|
| PubChem CID | 5366742 |
| Molecular Formula | C26H54O5Si2 |
| Molecular Weight | 502.89 g/mol |
| Exact Mass | 502.35 |
| IUPAC Name | methyl (Z)-11-methoxy-12,13-bis(trimethylsilyloxy)octadec-9-enoate |
| SMILES | CCCCCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(/C=C\CCCCCCCC(=O)OC)OC |
| InChI | InChI=1S/C26H54O5Si2/c1-10-11-17-21-24(30-32(4,5)6)26(31-33(7,8)9)23(28-2)20-18-15-13-12-14-16-19-22-25(27)29-3/h18,20,23-24,26H,10-17,19,21-22H2,1-9H3/b20-18- |
| InChIKey | AQNNZECPMNPRIO-ZZEZOPTASA-N |
| XLogP | 7.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.89 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|