C17H32O4Si — CID 91024847
ethyl 2-[(4R,6S)-2,2-ditert-butyl-6-ethenyl-1,3,2-dioxasilinan-4-yl]acetate (PubChem CID 91024847) has the molecular formula C17H32O4Si and a molecular weight of 328.53 g/mol. Its IUPAC name is ethyl 2-[(4R,6S)-2,2-ditert-butyl-6-ethenyl-1,3,2-dioxasilinan-4-yl]acetate.
| Compound Name | ethyl 2-[(4R,6S)-2,2-ditert-butyl-6-ethenyl-1,3,2-dioxasilinan-4-yl]acetate |
|---|---|
| PubChem CID | 91024847 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | ethyl 2-[(4R,6S)-2,2-ditert-butyl-6-ethenyl-1,3,2-dioxasilinan-4-yl]acetate |
| SMILES | C=C[C@@H]1C[C@H](CC(=O)OCC)O[Si](C(C)(C)C)(C(C)(C)C)O1 |
| InChI | InChI=1S/C17H32O4Si/c1-9-13-11-14(12-15(18)19-10-2)21-22(20-13,16(3,4)5)17(6,7)8/h9,13-14H,1,10-12H2,2-8H3/t13-,14-/m1/s1 |
| InChIKey | SPNWVLXDLQVOBM-ZIAGYGMSSA-N |
| XLogP | 4.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|