C23H48O4Si2 — CID 11113064
methyl (3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-tri(propan-2-yl)silyloxyhept-6-enoate (PubChem CID 11113064) has the molecular formula C23H48O4Si2 and a molecular weight of 444.81 g/mol. Its IUPAC name is methyl (3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-tri(propan-2-yl)silyloxyhept-6-enoate.
| Compound Name | methyl (3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-tri(propan-2-yl)silyloxyhept-6-enoate |
|---|---|
| PubChem CID | 11113064 |
| Molecular Formula | C23H48O4Si2 |
| Molecular Weight | 444.81 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | methyl (3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-tri(propan-2-yl)silyloxyhept-6-enoate |
| SMILES | C=C[C@H](C[C@H](CC(=O)OC)O[Si](C(C)C)(C(C)C)C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H48O4Si2/c1-14-20(26-28(12,13)23(8,9)10)15-21(16-22(24)25-11)27-29(17(2)3,18(4)5)19(6)7/h14,17-21H,1,15-16H2,2-13H3/t20-,21-/m1/s1 |
| InChIKey | XGGQBJSHGMVHFE-NHCUHLMSSA-N |
| XLogP | 7.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.81 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|